C22H20FN3O8S2 — CID 87229934
2-[2-[[3-[4-fluoro-2-(2-methoxyphenoxy)anilino]-3-oxopropanoyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid (PubChem CID 87229934) has the molecular formula C22H20FN3O8S2 and a molecular weight of 537.55 g/mol. Its IUPAC name is 2-[2-[[3-[4-fluoro-2-(2-methoxyphenoxy)anilino]-3-oxopropanoyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[[3-[4-fluoro-2-(2-methoxyphenoxy)anilino]-3-oxopropanoyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 87229934 |
| Molecular Formula | C22H20FN3O8S2 |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | 2-[2-[[3-[4-fluoro-2-(2-methoxyphenoxy)anilino]-3-oxopropanoyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1ccccc1Oc1cc(F)ccc1NC(=O)CC(=O)Nc1nc(CC(=O)O)c(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C22H20FN3O8S2/c1-33-15-5-3-4-6-16(15)34-17-9-12(23)7-8-13(17)24-18(27)11-19(28)26-22-25-14(10-20(29)30)21(35-22)36(2,31)32/h3-9H,10-11H2,1-2H3,(H,24,27)(H,29,30)(H,25,26,28) |
| InChIKey | IZSATBLKZWPHRD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 160.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|