C18H21N3O7S2 — CID 87230860
2-[2-[[2-[2-(2-methylpropoxy)anilino]-2-oxoacetyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid (PubChem CID 87230860) has the molecular formula C18H21N3O7S2 and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-[2-[[2-[2-(2-methylpropoxy)anilino]-2-oxoacetyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[[2-[2-(2-methylpropoxy)anilino]-2-oxoacetyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 87230860 |
| Molecular Formula | C18H21N3O7S2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 2-[2-[[2-[2-(2-methylpropoxy)anilino]-2-oxoacetyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid |
| SMILES | CC(C)COc1ccccc1NC(=O)C(=O)Nc1nc(CC(=O)O)c(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C18H21N3O7S2/c1-10(2)9-28-13-7-5-4-6-11(13)19-15(24)16(25)21-18-20-12(8-14(22)23)17(29-18)30(3,26)27/h4-7,10H,8-9H2,1-3H3,(H,19,24)(H,22,23)(H,20,21,25) |
| InChIKey | NYYUUMJCSBMRFI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 151.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|