C20H25N3O7S2 — CID 87231434
2-[2-[[3-[4-methyl-N-(2-methylpropoxy)anilino]-3-oxopropanoyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid (PubChem CID 87231434) has the molecular formula C20H25N3O7S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-[2-[[3-[4-methyl-N-(2-methylpropoxy)anilino]-3-oxopropanoyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[[3-[4-methyl-N-(2-methylpropoxy)anilino]-3-oxopropanoyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 87231434 |
| Molecular Formula | C20H25N3O7S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 2-[2-[[3-[4-methyl-N-(2-methylpropoxy)anilino]-3-oxopropanoyl]amino]-5-methylsulfonyl-1,3-thiazol-4-yl]acetic acid |
| SMILES | Cc1ccc(N(OCC(C)C)C(=O)CC(=O)Nc2nc(CC(=O)O)c(S(C)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C20H25N3O7S2/c1-12(2)11-30-23(14-7-5-13(3)6-8-14)17(25)10-16(24)22-20-21-15(9-18(26)27)19(31-20)32(4,28)29/h5-8,12H,9-11H2,1-4H3,(H,26,27)(H,21,22,24) |
| InChIKey | YFJKTYJRZFKQPN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|