C19H23N3O5S — CID 87231046
2-[2-[[3-[4-methyl-N-(2-methylpropoxy)anilino]-3-oxopropanoyl]amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 87231046) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-[2-[[3-[4-methyl-N-(2-methylpropoxy)anilino]-3-oxopropanoyl]amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[[3-[4-methyl-N-(2-methylpropoxy)anilino]-3-oxopropanoyl]amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 87231046 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-[2-[[3-[4-methyl-N-(2-methylpropoxy)anilino]-3-oxopropanoyl]amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | Cc1ccc(N(OCC(C)C)C(=O)CC(=O)Nc2nc(CC(=O)O)cs2)cc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-12(2)10-27-22(15-6-4-13(3)5-7-15)17(24)9-16(23)21-19-20-14(11-28-19)8-18(25)26/h4-7,11-12H,8-10H2,1-3H3,(H,25,26)(H,20,21,23) |
| InChIKey | ZVBIOOZPXULKNJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|