C18H24N4O5S2 — CID 87230669
N'-[4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N-[4-methyl-2-(2-methylpropoxy)phenyl]oxamide (PubChem CID 87230669) has the molecular formula C18H24N4O5S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N'-[4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N-[4-methyl-2-(2-methylpropoxy)phenyl]oxamide.
| Compound Name | N'-[4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N-[4-methyl-2-(2-methylpropoxy)phenyl]oxamide |
|---|---|
| PubChem CID | 87230669 |
| Molecular Formula | C18H24N4O5S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N'-[4-(methanesulfonamidomethyl)-1,3-thiazol-2-yl]-N-[4-methyl-2-(2-methylpropoxy)phenyl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2nc(CNS(C)(=O)=O)cs2)c(OCC(C)C)c1 |
| InChI | InChI=1S/C18H24N4O5S2/c1-11(2)9-27-15-7-12(3)5-6-14(15)21-16(23)17(24)22-18-20-13(10-28-18)8-19-29(4,25)26/h5-7,10-11,19H,8-9H2,1-4H3,(H,21,23)(H,20,22,24) |
| InChIKey | KPWYDUMQQCBVOH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|