C21H21ClN4O6S2 — CID 87229849
N'-[4-[amino(methylsulfonyl)methyl]-5-chloro-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenoxy)phenyl]propanediamide (PubChem CID 87229849) has the molecular formula C21H21ClN4O6S2 and a molecular weight of 525.01 g/mol. Its IUPAC name is N'-[4-[amino(methylsulfonyl)methyl]-5-chloro-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenoxy)phenyl]propanediamide.
| Compound Name | N'-[4-[amino(methylsulfonyl)methyl]-5-chloro-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenoxy)phenyl]propanediamide |
|---|---|
| PubChem CID | 87229849 |
| Molecular Formula | C21H21ClN4O6S2 |
| Molecular Weight | 525.01 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | N'-[4-[amino(methylsulfonyl)methyl]-5-chloro-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenoxy)phenyl]propanediamide |
| SMILES | COc1ccccc1Oc1ccccc1NC(=O)CC(=O)Nc1nc(C(N)S(C)(=O)=O)c(Cl)s1 |
| InChI | InChI=1S/C21H21ClN4O6S2/c1-31-14-9-5-6-10-15(14)32-13-8-4-3-7-12(13)24-16(27)11-17(28)25-21-26-18(19(22)33-21)20(23)34(2,29)30/h3-10,20H,11,23H2,1-2H3,(H,24,27)(H,25,26,28) |
| InChIKey | KBUDXHOCEUXDSD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.01 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|