C17H20Cl2N4OS — CID 8723194
4-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,6-dichloro-3-methylphenyl)butanamide (PubChem CID 8723194) has the molecular formula C17H20Cl2N4OS and a molecular weight of 399.35 g/mol. Its IUPAC name is 4-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,6-dichloro-3-methylphenyl)butanamide.
| Compound Name | 4-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,6-dichloro-3-methylphenyl)butanamide |
|---|---|
| PubChem CID | 8723194 |
| Molecular Formula | C17H20Cl2N4OS |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 4-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,6-dichloro-3-methylphenyl)butanamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)CCCSc2nnc(C)n2C2CC2)c1Cl |
| InChI | InChI=1S/C17H20Cl2N4OS/c1-10-5-8-13(18)16(15(10)19)20-14(24)4-3-9-25-17-22-21-11(2)23(17)12-6-7-12/h5,8,12H,3-4,6-7,9H2,1-2H3,(H,20,24) |
| InChIKey | ZZFHJTGOLOXQDB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|