C15H26O2 — CID 87232686
(2S,3S)-2,3,8-trimethyl-2-prop-1-en-2-ylnon-7-enoic acid (PubChem CID 87232686) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2S,3S)-2,3,8-trimethyl-2-prop-1-en-2-ylnon-7-enoic acid.
| Compound Name | (2S,3S)-2,3,8-trimethyl-2-prop-1-en-2-ylnon-7-enoic acid |
|---|---|
| PubChem CID | 87232686 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (2S,3S)-2,3,8-trimethyl-2-prop-1-en-2-ylnon-7-enoic acid |
| SMILES | C=C(C)[C@@](C)(C(=O)O)[C@@H](C)CCCC=C(C)C |
| InChI | InChI=1S/C15H26O2/c1-11(2)9-7-8-10-13(5)15(6,12(3)4)14(16)17/h9,13H,3,7-8,10H2,1-2,4-6H3,(H,16,17)/t13-,15+/m0/s1 |
| InChIKey | JLLPZNWMUMCYDD-DZGCQCFKSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|