About methanesulfonoperoxoic acid;styrene
methanesulfonoperoxoic acid;styrene (PubChem CID 87237870) has the molecular formula C9H12O4S
and a molecular weight of 216.26 g/mol. Its IUPAC name is methanesulfonoperoxoic acid;styrene.
Molecular Properties
| Compound Name | methanesulfonoperoxoic acid;styrene |
| PubChem CID | 87237870 |
| Molecular Formula | C9H12O4S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | methanesulfonoperoxoic acid;styrene |
| SMILES | C=Cc1ccccc1.CS(=O)(=O)OO |
| InChI | InChI=1S/C8H8.CH4O4S/c1-2-8-6-4-3-5-7-8;1-6(3,4)5-2/h2-7H,1H2;2H,1H3 |
| InChIKey | SFVRVBDNYXCZAY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonoperoxoic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonoperoxoic acid;styrene?
The IUPAC name of methanesulfonoperoxoic acid;styrene (CID 87237870) is methanesulfonoperoxoic acid;styrene.
What is the SMILES notation for methanesulfonoperoxoic acid;styrene?
The canonical SMILES for methanesulfonoperoxoic acid;styrene is C=Cc1ccccc1.CS(=O)(=O)OO.
What is the InChIKey of methanesulfonoperoxoic acid;styrene?
The InChIKey is SFVRVBDNYXCZAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.CH4O4S/c1-2-8-6-4-3-5-7-8;1-6(3,4)5-2/h2-7H,1H2;2H,1H3.
What are the key properties of methanesulfonoperoxoic acid;styrene?
methanesulfonoperoxoic acid;styrene has a molecular weight of 216.26 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonoperoxoic acid;styrene is sourced from PubChem (CID 87237870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).