C32H33F3N2O5 — CID 87239101
ethyl 1-[4-(diethylamino)phenyl]-2-(2-ethoxy-2-oxoethyl)-5-(2,3,5-trifluoro-4-methylphenoxy)indole-3-carboxylate (PubChem CID 87239101) has the molecular formula C32H33F3N2O5 and a molecular weight of 582.62 g/mol. Its IUPAC name is ethyl 1-[4-(diethylamino)phenyl]-2-(2-ethoxy-2-oxoethyl)-5-(2,3,5-trifluoro-4-methylphenoxy)indole-3-carboxylate.
| Compound Name | ethyl 1-[4-(diethylamino)phenyl]-2-(2-ethoxy-2-oxoethyl)-5-(2,3,5-trifluoro-4-methylphenoxy)indole-3-carboxylate |
|---|---|
| PubChem CID | 87239101 |
| Molecular Formula | C32H33F3N2O5 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | ethyl 1-[4-(diethylamino)phenyl]-2-(2-ethoxy-2-oxoethyl)-5-(2,3,5-trifluoro-4-methylphenoxy)indole-3-carboxylate |
| SMILES | CCOC(=O)Cc1c(C(=O)OCC)c2cc(Oc3cc(F)c(C)c(F)c3F)ccc2n1-c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C32H33F3N2O5/c1-6-36(7-2)20-10-12-21(13-11-20)37-25-15-14-22(42-27-17-24(33)19(5)30(34)31(27)35)16-23(25)29(32(39)41-9-4)26(37)18-28(38)40-8-3/h10-17H,6-9,18H2,1-5H3 |
| InChIKey | SDQIGSMANLBOIA-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|