C18H28N4OS — CID 8723967
(2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 8723967) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 8723967 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[(5-cyclopropyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CCn1c(S[C@@H](C)C(=O)NCCC2=CCCCC2)nnc1C1CC1 |
| InChI | InChI=1S/C18H28N4OS/c1-3-22-16(15-9-10-15)20-21-18(22)24-13(2)17(23)19-12-11-14-7-5-4-6-8-14/h7,13,15H,3-6,8-12H2,1-2H3,(H,19,23)/t13-/m0/s1 |
| InChIKey | BQIKJMUTELTQED-ZDUSSCGKSA-N |
| XLogP | 3.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|