About 2,6-dimethyloct-7-enyl dihydrogen phosphate
2,6-dimethyloct-7-enyl dihydrogen phosphate (PubChem CID 87240044) has the molecular formula C10H21O4P
and a molecular weight of 236.25 g/mol. Its IUPAC name is 2,6-dimethyloct-7-enyl dihydrogen phosphate.
Molecular Properties
| Compound Name | 2,6-dimethyloct-7-enyl dihydrogen phosphate |
| PubChem CID | 87240044 |
| Molecular Formula | C10H21O4P |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2,6-dimethyloct-7-enyl dihydrogen phosphate |
| SMILES | C=CC(C)CCCC(C)COP(=O)(O)O |
| InChI | InChI=1S/C10H21O4P/c1-4-9(2)6-5-7-10(3)8-14-15(11,12)13/h4,9-10H,1,5-8H2,2-3H3,(H2,11,12,13) |
| InChIKey | MICOWJQDRSWIJM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyloct-7-enyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyloct-7-enyl dihydrogen phosphate?
The IUPAC name of 2,6-dimethyloct-7-enyl dihydrogen phosphate (CID 87240044) is 2,6-dimethyloct-7-enyl dihydrogen phosphate.
What is the SMILES notation for 2,6-dimethyloct-7-enyl dihydrogen phosphate?
The canonical SMILES for 2,6-dimethyloct-7-enyl dihydrogen phosphate is C=CC(C)CCCC(C)COP(=O)(O)O.
What is the InChIKey of 2,6-dimethyloct-7-enyl dihydrogen phosphate?
The InChIKey is MICOWJQDRSWIJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21O4P/c1-4-9(2)6-5-7-10(3)8-14-15(11,12)13/h4,9-10H,1,5-8H2,2-3H3,(H2,11,12,13).
What are the key properties of 2,6-dimethyloct-7-enyl dihydrogen phosphate?
2,6-dimethyloct-7-enyl dihydrogen phosphate has a molecular weight of 236.25 g/mol, XLogP of 2.72, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyloct-7-enyl dihydrogen phosphate is sourced from PubChem (CID 87240044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).