C46H61P3 — CID 87241694
[2-[bis[(3,5-dimethyl-1-adamantyl)phosphanyl]methyl]phenyl]methyl-bis(2-methylphenyl)phosphane (PubChem CID 87241694) has the molecular formula C46H61P3 and a molecular weight of 706.92 g/mol. Its IUPAC name is [2-[bis[(3,5-dimethyl-1-adamantyl)phosphanyl]methyl]phenyl]methyl-bis(2-methylphenyl)phosphane.
| Compound Name | [2-[bis[(3,5-dimethyl-1-adamantyl)phosphanyl]methyl]phenyl]methyl-bis(2-methylphenyl)phosphane |
|---|---|
| PubChem CID | 87241694 |
| Molecular Formula | C46H61P3 |
| Molecular Weight | 706.92 g/mol |
| Exact Mass | 706.40 |
| IUPAC Name | [2-[bis[(3,5-dimethyl-1-adamantyl)phosphanyl]methyl]phenyl]methyl-bis(2-methylphenyl)phosphane |
| SMILES | Cc1ccccc1P(Cc1ccccc1C(PC12CC3CC(C)(CC(C)(C3)C1)C2)PC12CC3CC(C)(CC(C)(C3)C1)C2)c1ccccc1C |
| InChI | InChI=1S/C46H61P3/c1-32-13-7-11-17-38(32)49(39-18-12-8-14-33(39)2)25-36-15-9-10-16-37(36)40(47-45-23-34-19-41(3,28-45)26-42(4,20-34)29-45)48-46-24-35-21-43(5,30-46)27-44(6,22-35)31-46/h7-18,34-35,40,47-48H,19-31H2,1-6H3 |
| InChIKey | JSWWQYTUCKNLOK-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.92 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|