C19H18Cl2N4 — CID 87241812
3-chloro-4-(1-chloro-2,6-naphthyridin-3-yl)-N-cyclohexylpyridin-2-amine (PubChem CID 87241812) has the molecular formula C19H18Cl2N4 and a molecular weight of 373.29 g/mol. Its IUPAC name is 3-chloro-4-(1-chloro-2,6-naphthyridin-3-yl)-N-cyclohexylpyridin-2-amine.
| Compound Name | 3-chloro-4-(1-chloro-2,6-naphthyridin-3-yl)-N-cyclohexylpyridin-2-amine |
|---|---|
| PubChem CID | 87241812 |
| Molecular Formula | C19H18Cl2N4 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 3-chloro-4-(1-chloro-2,6-naphthyridin-3-yl)-N-cyclohexylpyridin-2-amine |
| SMILES | Clc1c(-c2cc3cnccc3c(Cl)n2)ccnc1NC1CCCCC1 |
| InChI | InChI=1S/C19H18Cl2N4/c20-17-15(7-9-23-19(17)24-13-4-2-1-3-5-13)16-10-12-11-22-8-6-14(12)18(21)25-16/h6-11,13H,1-5H2,(H,23,24) |
| InChIKey | VTTQFCZDQNIXSK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|