C22H26N6 — CID 67026736
N-cyclopentyl-4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)pyridin-2-amine (PubChem CID 67026736) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-cyclopentyl-4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)pyridin-2-amine.
| Compound Name | N-cyclopentyl-4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 67026736 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | N-cyclopentyl-4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)pyridin-2-amine |
| SMILES | c1cc2c(N3CCNCC3)nc(-c3ccnc(NC4CCCC4)c3)cc2cn1 |
| InChI | InChI=1S/C22H26N6/c1-2-4-18(3-1)26-21-14-16(5-8-25-21)20-13-17-15-24-7-6-19(17)22(27-20)28-11-9-23-10-12-28/h5-8,13-15,18,23H,1-4,9-12H2,(H,25,26) |
| InChIKey | VEUWZVPPUQWXBG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |