C21H30N6 — CID 67088547
4-[4-(aminomethyl)-6-piperazin-1-yl-2-pyridinyl]-N-cyclohexylpyridin-2-amine (PubChem CID 67088547) has the molecular formula C21H30N6 and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-6-piperazin-1-yl-2-pyridinyl]-N-cyclohexylpyridin-2-amine.
| Compound Name | 4-[4-(aminomethyl)-6-piperazin-1-yl-2-pyridinyl]-N-cyclohexylpyridin-2-amine |
|---|---|
| PubChem CID | 67088547 |
| Molecular Formula | C21H30N6 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 4-[4-(aminomethyl)-6-piperazin-1-yl-2-pyridinyl]-N-cyclohexylpyridin-2-amine |
| SMILES | NCc1cc(-c2ccnc(NC3CCCCC3)c2)nc(N2CCNCC2)c1 |
| InChI | InChI=1S/C21H30N6/c22-15-16-12-19(26-21(13-16)27-10-8-23-9-11-27)17-6-7-24-20(14-17)25-18-4-2-1-3-5-18/h6-7,12-14,18,23H,1-5,8-11,15,22H2,(H,24,25) |
| InChIKey | GCRSEDBVPIVYLT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |