C22H31N5 — CID 58229709
[2-[2-(cyclohexylmethyl)-4-pyridinyl]-6-piperazin-1-yl-4-pyridinyl]methanamine (PubChem CID 58229709) has the molecular formula C22H31N5 and a molecular weight of 365.53 g/mol. Its IUPAC name is [2-[2-(cyclohexylmethyl)-4-pyridinyl]-6-piperazin-1-yl-4-pyridinyl]methanamine.
| Compound Name | [2-[2-(cyclohexylmethyl)-4-pyridinyl]-6-piperazin-1-yl-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 58229709 |
| Molecular Formula | C22H31N5 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | [2-[2-(cyclohexylmethyl)-4-pyridinyl]-6-piperazin-1-yl-4-pyridinyl]methanamine |
| SMILES | NCc1cc(-c2ccnc(CC3CCCCC3)c2)nc(N2CCNCC2)c1 |
| InChI | InChI=1S/C22H31N5/c23-16-18-13-21(26-22(14-18)27-10-8-24-9-11-27)19-6-7-25-20(15-19)12-17-4-2-1-3-5-17/h6-7,13-15,17,24H,1-5,8-12,16,23H2 |
| InChIKey | QPNFUNNNFABPIS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |