C27H33N7O — CID 67088464
1-[2-[2-(cyclohexylamino)-4-pyridinyl]-6-piperazin-1-yl-4-pyridinyl]-3-phenylurea (PubChem CID 67088464) has the molecular formula C27H33N7O and a molecular weight of 471.61 g/mol. Its IUPAC name is 1-[2-[2-(cyclohexylamino)-4-pyridinyl]-6-piperazin-1-yl-4-pyridinyl]-3-phenylurea.
| Compound Name | 1-[2-[2-(cyclohexylamino)-4-pyridinyl]-6-piperazin-1-yl-4-pyridinyl]-3-phenylurea |
|---|---|
| PubChem CID | 67088464 |
| Molecular Formula | C27H33N7O |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 1-[2-[2-(cyclohexylamino)-4-pyridinyl]-6-piperazin-1-yl-4-pyridinyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cc(-c2ccnc(NC3CCCCC3)c2)nc(N2CCNCC2)c1 |
| InChI | InChI=1S/C27H33N7O/c35-27(31-22-9-5-2-6-10-22)32-23-18-24(33-26(19-23)34-15-13-28-14-16-34)20-11-12-29-25(17-20)30-21-7-3-1-4-8-21/h2,5-6,9-12,17-19,21,28H,1,3-4,7-8,13-16H2,(H,29,30)(H2,31,32,33,35) |
| InChIKey | MKLPNPYQJNJAGV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |