C27H30N6 — CID 67088806
4-[2-[2-(cyclohexylamino)-4-pyridinyl]-6-piperazin-1-yl-3-pyridinyl]benzonitrile (PubChem CID 67088806) has the molecular formula C27H30N6 and a molecular weight of 438.58 g/mol. Its IUPAC name is 4-[2-[2-(cyclohexylamino)-4-pyridinyl]-6-piperazin-1-yl-3-pyridinyl]benzonitrile.
| Compound Name | 4-[2-[2-(cyclohexylamino)-4-pyridinyl]-6-piperazin-1-yl-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 67088806 |
| Molecular Formula | C27H30N6 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 4-[2-[2-(cyclohexylamino)-4-pyridinyl]-6-piperazin-1-yl-3-pyridinyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(N3CCNCC3)nc2-c2ccnc(NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C27H30N6/c28-19-20-6-8-21(9-7-20)24-10-11-26(33-16-14-29-15-17-33)32-27(24)22-12-13-30-25(18-22)31-23-4-2-1-3-5-23/h6-13,18,23,29H,1-5,14-17H2,(H,30,31) |
| InChIKey | LUAUMFVLXYVAMN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |