C22H24Cl2N6 — CID 122446737
6,7-dichloro-N-cyclopentyl-4-(2-piperazin-1-yl-4-pyridinyl)phthalazin-1-amine (PubChem CID 122446737) has the molecular formula C22H24Cl2N6 and a molecular weight of 443.38 g/mol. Its IUPAC name is 6,7-dichloro-N-cyclopentyl-4-(2-piperazin-1-yl-4-pyridinyl)phthalazin-1-amine.
| Compound Name | 6,7-dichloro-N-cyclopentyl-4-(2-piperazin-1-yl-4-pyridinyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 122446737 |
| Molecular Formula | C22H24Cl2N6 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 6,7-dichloro-N-cyclopentyl-4-(2-piperazin-1-yl-4-pyridinyl)phthalazin-1-amine |
| SMILES | Clc1cc2c(NC3CCCC3)nnc(-c3ccnc(N4CCNCC4)c3)c2cc1Cl |
| InChI | InChI=1S/C22H24Cl2N6/c23-18-12-16-17(13-19(18)24)22(27-15-3-1-2-4-15)29-28-21(16)14-5-6-26-20(11-14)30-9-7-25-8-10-30/h5-6,11-13,15,25H,1-4,7-10H2,(H,27,29) |
| InChIKey | JFWCSAHGMOYTEW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |