About 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine
4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine (PubChem CID 67026531) has the molecular formula C20H24N6
and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine.
Molecular Properties
| Compound Name | 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine |
| PubChem CID | 67026531 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine |
| SMILES | CC(C)Nc1cc(-c2cc3cnccc3c(N3CCNCC3)n2)ccn1 |
| InChI | InChI=1S/C20H24N6/c1-14(2)24-19-12-15(3-6-23-19)18-11-16-13-22-5-4-17(16)20(25-18)26-9-7-21-8-10-26/h3-6,11-14,21H,7-10H2,1-2H3,(H,23,24) |
| InChIKey | SMLRNQKZFYTLJU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine?
The IUPAC name of 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine (CID 67026531) is 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine.
What is the SMILES notation for 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine?
The canonical SMILES for 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine is CC(C)Nc1cc(-c2cc3cnccc3c(N3CCNCC3)n2)ccn1.
What is the InChIKey of 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine?
The InChIKey is SMLRNQKZFYTLJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6/c1-14(2)24-19-12-15(3-6-23-19)18-11-16-13-22-5-4-17(16)20(25-18)26-9-7-21-8-10-26/h3-6,11-14,21H,7-10H2,1-2H3,(H,23,24).
What are the key properties of 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine?
4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine has a molecular weight of 348.45 g/mol, XLogP of 2.92, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-piperazin-1-yl-2,6-naphthyridin-3-yl)-N-propan-2-ylpyridin-2-amine is sourced from PubChem (CID 67026531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).