C18H20FN5O5S — CID 87244404
1-[3-[[(3aS,5R)-2-methyl-1,1-dioxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazol-5-yl]oxy]-5-fluorophenyl]-1-hydroxy-3-pyridin-3-ylurea (PubChem CID 87244404) has the molecular formula C18H20FN5O5S and a molecular weight of 437.45 g/mol. Its IUPAC name is 1-[3-[[(3aS,5R)-2-methyl-1,1-dioxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazol-5-yl]oxy]-5-fluorophenyl]-1-hydroxy-3-pyridin-3-ylurea.
| Compound Name | 1-[3-[[(3aS,5R)-2-methyl-1,1-dioxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazol-5-yl]oxy]-5-fluorophenyl]-1-hydroxy-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 87244404 |
| Molecular Formula | C18H20FN5O5S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-[3-[[(3aS,5R)-2-methyl-1,1-dioxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2,5]thiadiazol-5-yl]oxy]-5-fluorophenyl]-1-hydroxy-3-pyridin-3-ylurea |
| SMILES | CN1C[C@@H]2C[C@@H](Oc3cc(F)cc(N(O)C(=O)Nc4cccnc4)c3)CN2S1(=O)=O |
| InChI | InChI=1S/C18H20FN5O5S/c1-22-10-15-8-17(11-23(15)30(22,27)28)29-16-6-12(19)5-14(7-16)24(26)18(25)21-13-3-2-4-20-9-13/h2-7,9,15,17,26H,8,10-11H2,1H3,(H,21,25)/t15-,17+/m0/s1 |
| InChIKey | JPZVMHBHUQSQEQ-DOTOQJQBSA-N |
| XLogP | 1.66 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|