C6H10N2P2 — CID 87247187
1-N,4-N-bis(phosphanyl)benzene-1,4-diamine (PubChem CID 87247187) has the molecular formula C6H10N2P2 and a molecular weight of 172.11 g/mol. Its IUPAC name is 1-N,4-N-bis(phosphanyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(phosphanyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 87247187 |
| Molecular Formula | C6H10N2P2 |
| Molecular Weight | 172.11 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 1-N,4-N-bis(phosphanyl)benzene-1,4-diamine |
| SMILES | PNc1ccc(NP)cc1 |
| InChI | InChI=1S/C6H10N2P2/c9-7-5-1-2-6(8-10)4-3-5/h1-4,7-8H,9-10H2 |
| InChIKey | XOTIQWTXEQUOSZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.11 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|