C15H34O3 — CID 87248461
3-methyl-3-(2-methylpropoxy)butan-1-ol;1-propoxypropane (PubChem CID 87248461) has the molecular formula C15H34O3 and a molecular weight of 262.43 g/mol. Its IUPAC name is 3-methyl-3-(2-methylpropoxy)butan-1-ol;1-propoxypropane.
| Compound Name | 3-methyl-3-(2-methylpropoxy)butan-1-ol;1-propoxypropane |
|---|---|
| PubChem CID | 87248461 |
| Molecular Formula | C15H34O3 |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | 3-methyl-3-(2-methylpropoxy)butan-1-ol;1-propoxypropane |
| SMILES | CC(C)COC(C)(C)CCO.CCCOCCC |
| InChI | InChI=1S/C9H20O2.C6H14O/c1-8(2)7-11-9(3,4)5-6-10;1-3-5-7-6-4-2/h8,10H,5-7H2,1-4H3;3-6H2,1-2H3 |
| InChIKey | BFKUWTHHHJACSX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|