C15H15NO — CID 87250258
N-(3,5-dimethylphenyl)-N-phenylformamide (PubChem CID 87250258) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N-phenylformamide.
| Compound Name | N-(3,5-dimethylphenyl)-N-phenylformamide |
|---|---|
| PubChem CID | 87250258 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N-phenylformamide |
| SMILES | Cc1cc(C)cc(N(C=O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H15NO/c1-12-8-13(2)10-15(9-12)16(11-17)14-6-4-3-5-7-14/h3-11H,1-2H3 |
| InChIKey | BQMXDTXKRVDOQI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|