C13H24BrClN2O6 — CID 87252337
2-bromo-N-carbamoyl-2-ethylbutanamide;hexanedioic acid;hydrochloride (PubChem CID 87252337) has the molecular formula C13H24BrClN2O6 and a molecular weight of 419.70 g/mol. Its IUPAC name is 2-bromo-N-carbamoyl-2-ethylbutanamide;hexanedioic acid;hydrochloride.
| Compound Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;hexanedioic acid;hydrochloride |
|---|---|
| PubChem CID | 87252337 |
| Molecular Formula | C13H24BrClN2O6 |
| Molecular Weight | 419.70 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;hexanedioic acid;hydrochloride |
| SMILES | CCC(Br)(CC)C(=O)NC(N)=O.Cl.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C7H13BrN2O2.C6H10O4.ClH/c1-3-7(8,4-2)5(11)10-6(9)12;7-5(8)3-1-2-4-6(9)10;/h3-4H2,1-2H3,(H3,9,10,11,12);1-4H2,(H,7,8)(H,9,10);1H |
| InChIKey | OXKCWUAYCLQEFS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.70 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|