C9H19NO5Sm — CID 87252490
2-amino-2-(hydroxymethyl)propane-1,3-diol;(Z)-4-hydroxypent-3-en-2-one;samarium (PubChem CID 87252490) has the molecular formula C9H19NO5Sm and a molecular weight of 371.61 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;(Z)-4-hydroxypent-3-en-2-one;samarium.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;(Z)-4-hydroxypent-3-en-2-one;samarium |
|---|---|
| PubChem CID | 87252490 |
| Molecular Formula | C9H19NO5Sm |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;(Z)-4-hydroxypent-3-en-2-one;samarium |
| SMILES | CC(=O)/C=C(/C)O.NC(CO)(CO)CO.[Sm] |
| InChI | InChI=1S/C5H8O2.C4H11NO3.Sm/c1-4(6)3-5(2)7;5-4(1-6,2-7)3-8;/h3,6H,1-2H3;6-8H,1-3,5H2;/b4-3-;; |
| InChIKey | XJYRXDQUICHDPM-GSBNXNDCSA-N |
| XLogP | -1.30 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|