About ethanol;4-hydroxypent-3-en-2-one;tantalum
ethanol;4-hydroxypent-3-en-2-one;tantalum (PubChem CID 155886326) has the molecular formula C13H32O6Ta
and a molecular weight of 465.34 g/mol. Its IUPAC name is ethanol;4-hydroxypent-3-en-2-one;tantalum.
Molecular Properties
| Compound Name | ethanol;4-hydroxypent-3-en-2-one;tantalum |
| PubChem CID | 155886326 |
| Molecular Formula | C13H32O6Ta |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | ethanol;4-hydroxypent-3-en-2-one;tantalum |
| SMILES | CC(=O)C=C(C)O.CCO.CCO.CCO.CCO.[Ta] |
| InChI | InChI=1S/C5H8O2.4C2H6O.Ta/c1-4(6)3-5(2)7;4*1-2-3;/h3,6H,1-2H3;4*3H,2H2,1H3; |
| InChIKey | YMZNJFSVFJDLIR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethanol;4-hydroxypent-3-en-2-one;tantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;4-hydroxypent-3-en-2-one;tantalum?
The IUPAC name of ethanol;4-hydroxypent-3-en-2-one;tantalum (CID 155886326) is ethanol;4-hydroxypent-3-en-2-one;tantalum.
What is the SMILES notation for ethanol;4-hydroxypent-3-en-2-one;tantalum?
The canonical SMILES for ethanol;4-hydroxypent-3-en-2-one;tantalum is CC(=O)C=C(C)O.CCO.CCO.CCO.CCO.[Ta].
What is the InChIKey of ethanol;4-hydroxypent-3-en-2-one;tantalum?
The InChIKey is YMZNJFSVFJDLIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.4C2H6O.Ta/c1-4(6)3-5(2)7;4*1-2-3;/h3,6H,1-2H3;4*3H,2H2,1H3;.
What are the key properties of ethanol;4-hydroxypent-3-en-2-one;tantalum?
ethanol;4-hydroxypent-3-en-2-one;tantalum has a molecular weight of 465.34 g/mol, XLogP of 1.03, 1 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;4-hydroxypent-3-en-2-one;tantalum is sourced from PubChem (CID 155886326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).