C11H22N2O6 — CID 87257204
(2S)-2-amino-3-methylpentanoic acid;(2S)-2-aminopentanedioic acid (PubChem CID 87257204) has the molecular formula C11H22N2O6 and a molecular weight of 278.31 g/mol. Its IUPAC name is (2S)-2-amino-3-methylpentanoic acid;(2S)-2-aminopentanedioic acid.
| Compound Name | (2S)-2-amino-3-methylpentanoic acid;(2S)-2-aminopentanedioic acid |
|---|---|
| PubChem CID | 87257204 |
| Molecular Formula | C11H22N2O6 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (2S)-2-amino-3-methylpentanoic acid;(2S)-2-aminopentanedioic acid |
| SMILES | CCC(C)[C@H](N)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H13NO2.C5H9NO4/c1-3-4(2)5(7)6(8)9;6-3(5(9)10)1-2-4(7)8/h4-5H,3,7H2,1-2H3,(H,8,9);3H,1-2,6H2,(H,7,8)(H,9,10)/t4?,5-;3-/m00/s1 |
| InChIKey | YWOLSBHQLNEVOL-HAAMJTKLSA-N |
| XLogP | -0.29 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |