C10H18N2O8 — CID 122610243
2-amino-3-methylbutanedioic acid;2-aminopentanedioic acid (PubChem CID 122610243) has the molecular formula C10H18N2O8 and a molecular weight of 294.26 g/mol. Its IUPAC name is 2-amino-3-methylbutanedioic acid;2-aminopentanedioic acid.
| Compound Name | 2-amino-3-methylbutanedioic acid;2-aminopentanedioic acid |
|---|---|
| PubChem CID | 122610243 |
| Molecular Formula | C10H18N2O8 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-amino-3-methylbutanedioic acid;2-aminopentanedioic acid |
| SMILES | CC(C(=O)O)C(N)C(=O)O.NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/2C5H9NO4/c1-2(4(7)8)3(6)5(9)10;6-3(5(9)10)1-2-4(7)8/h2-3H,6H2,1H3,(H,7,8)(H,9,10);3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | SDEVUCPGHGNPRM-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |