C12H25N3O8 — CID 22856238
2-aminoacetic acid;(2S)-2-amino-3-methylbutanoic acid;(2S)-2-aminopentanedioic acid (PubChem CID 22856238) has the molecular formula C12H25N3O8 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-aminoacetic acid;(2S)-2-amino-3-methylbutanoic acid;(2S)-2-aminopentanedioic acid.
| Compound Name | 2-aminoacetic acid;(2S)-2-amino-3-methylbutanoic acid;(2S)-2-aminopentanedioic acid |
|---|---|
| PubChem CID | 22856238 |
| Molecular Formula | C12H25N3O8 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-aminoacetic acid;(2S)-2-amino-3-methylbutanoic acid;(2S)-2-aminopentanedioic acid |
| SMILES | CC(C)[C@H](N)C(=O)O.NCC(=O)O.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.C5H11NO2.C2H5NO2/c6-3(5(9)10)1-2-4(7)8;1-3(2)4(6)5(7)8;3-1-2(4)5/h3H,1-2,6H2,(H,7,8)(H,9,10);3-4H,6H2,1-2H3,(H,7,8);1,3H2,(H,4,5)/t3-;4-;/m00./s1 |
| InChIKey | BGUPSHYNPPLEEJ-ILCMOUOISA-N |
| XLogP | -1.65 |
| TPSA | 227.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |