C9H17NO6 — CID 87123130
2-amino-3-methylbutanoic acid;butanedioic acid (PubChem CID 87123130) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-amino-3-methylbutanoic acid;butanedioic acid.
| Compound Name | 2-amino-3-methylbutanoic acid;butanedioic acid |
|---|---|
| PubChem CID | 87123130 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-amino-3-methylbutanoic acid;butanedioic acid |
| SMILES | CC(C)C(N)C(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C5H11NO2.C4H6O4/c1-3(2)4(6)5(7)8;5-3(6)1-2-4(7)8/h3-4H,6H2,1-2H3,(H,7,8);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | ILLDYDWDMHAKTD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |