C43H38F6O10 — CID 87260284
[4-[(1E,7E)-5,5-dihydroxy-4-methyl-3,6-dioxo-8-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]octa-1,7-dienyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 87260284) has the molecular formula C43H38F6O10 and a molecular weight of 828.76 g/mol. Its IUPAC name is [4-[(1E,7E)-5,5-dihydroxy-4-methyl-3,6-dioxo-8-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]octa-1,7-dienyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | [4-[(1E,7E)-5,5-dihydroxy-4-methyl-3,6-dioxo-8-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]octa-1,7-dienyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 87260284 |
| Molecular Formula | C43H38F6O10 |
| Molecular Weight | 828.76 g/mol |
| Exact Mass | 828.24 |
| IUPAC Name | [4-[(1E,7E)-5,5-dihydroxy-4-methyl-3,6-dioxo-8-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]octa-1,7-dienyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | CC(C(=O)/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1)C(O)(O)C(=O)/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C43H38F6O10/c1-28(37(50)22-8-29-4-14-35(15-5-29)58-39(52)31-10-18-33(19-11-31)56-26-2-24-41(44,45)46)43(54,55)38(51)23-9-30-6-16-36(17-7-30)59-40(53)32-12-20-34(21-13-32)57-27-3-25-42(47,48)49/h4-23,28,54-55H,2-3,24-27H2,1H3/b22-8+,23-9+ |
| InChIKey | AJNTVHLUQLPSCD-NZRSMXNRSA-N |
| XLogP | 8.75 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.76 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|