C51H66N16O5 — CID 87260832
bis[2-[4-[6-(3-hydroxyphenyl)-2-morpholin-4-ylpurin-9-yl]piperidin-1-yl]-4-methylpiperazin-1-yl]methanone (PubChem CID 87260832) has the molecular formula C51H66N16O5 and a molecular weight of 983.20 g/mol. Its IUPAC name is bis[2-[4-[6-(3-hydroxyphenyl)-2-morpholin-4-ylpurin-9-yl]piperidin-1-yl]-4-methylpiperazin-1-yl]methanone.
| Compound Name | bis[2-[4-[6-(3-hydroxyphenyl)-2-morpholin-4-ylpurin-9-yl]piperidin-1-yl]-4-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 87260832 |
| Molecular Formula | C51H66N16O5 |
| Molecular Weight | 983.20 g/mol |
| Exact Mass | 982.54 |
| IUPAC Name | bis[2-[4-[6-(3-hydroxyphenyl)-2-morpholin-4-ylpurin-9-yl]piperidin-1-yl]-4-methylpiperazin-1-yl]methanone |
| SMILES | CN1CCN(C(=O)N2CCN(C)CC2N2CCC(n3cnc4c(-c5cccc(O)c5)nc(N5CCOCC5)nc43)CC2)C(N2CCC(n3cnc4c(-c5cccc(O)c5)nc(N5CCOCC5)nc43)CC2)C1 |
| InChI | InChI=1S/C51H66N16O5/c1-58-17-19-64(41(31-58)60-13-9-37(10-14-60)66-33-52-45-43(35-5-3-7-39(68)29-35)54-49(56-47(45)66)62-21-25-71-26-22-62)51(70)65-20-18-59(2)32-42(65)61-15-11-38(12-16-61)67-34-53-46-44(36-6-4-8-40(69)30-36)55-50(57-48(46)67)63-23-27-72-28-24-63/h3-8,29-30,33-34,37-38,41-42,68-69H,9-28,31-32H2,1-2H3 |
| InChIKey | RSGITLKOHYKQHT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 189.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 19 |