C10H20N2O4S — CID 87261916
2-butyl-3-methyl-1H-imidazol-3-ium;ethyl sulfate (PubChem CID 87261916) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-butyl-3-methyl-1H-imidazol-3-ium;ethyl sulfate.
| Compound Name | 2-butyl-3-methyl-1H-imidazol-3-ium;ethyl sulfate |
|---|---|
| PubChem CID | 87261916 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-butyl-3-methyl-1H-imidazol-3-ium;ethyl sulfate |
| SMILES | CCCCc1[nH]cc[n+]1C.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H14N2.C2H6O4S/c1-3-4-5-8-9-6-7-10(8)2;1-2-6-7(3,4)5/h6-7H,3-5H2,1-2H3;2H2,1H3,(H,3,4,5) |
| InChIKey | HUVPZQCFFRWALE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|