C7H13FN2O3S — CID 90333372
CID 90333372 (PubChem CID 90333372) has the molecular formula C7H13FN2O3S and a molecular weight of 224.26 g/mol.
| Compound Name | CID 90333372 |
|---|---|
| PubChem CID | 90333372 |
| Molecular Formula | C7H13FN2O3S |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | — |
| SMILES | CCCc1[nH]cc[n+]1C.O=S(=O)([O-])F |
| InChI | InChI=1S/C7H12N2.FHO3S/c1-3-4-7-8-5-6-9(7)2;1-5(2,3)4/h5-6H,3-4H2,1-2H3;(H,2,3,4) |
| InChIKey | XCHODBUZNOCQRF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|