C10H11F9N2O3S — CID 23144966
2-ethyl-3-methyl-1H-imidazol-3-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 23144966) has the molecular formula C10H11F9N2O3S and a molecular weight of 410.26 g/mol. Its IUPAC name is 2-ethyl-3-methyl-1H-imidazol-3-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | 2-ethyl-3-methyl-1H-imidazol-3-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 23144966 |
| Molecular Formula | C10H11F9N2O3S |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-ethyl-3-methyl-1H-imidazol-3-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCc1[nH]cc[n+]1C.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H10N2.C4HF9O3S/c1-3-6-7-4-5-8(6)2;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h4-5H,3H2,1-2H3;(H,14,15,16) |
| InChIKey | CGBIQADMUFXPTP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|