C13H25N4O4P — CID 69083321
bis(2-ethyl-3-methyl-1H-imidazol-3-ium);methyl phosphate (PubChem CID 69083321) has the molecular formula C13H25N4O4P and a molecular weight of 332.34 g/mol. Its IUPAC name is bis(2-ethyl-3-methyl-1H-imidazol-3-ium);methyl phosphate.
| Compound Name | bis(2-ethyl-3-methyl-1H-imidazol-3-ium);methyl phosphate |
|---|---|
| PubChem CID | 69083321 |
| Molecular Formula | C13H25N4O4P |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | bis(2-ethyl-3-methyl-1H-imidazol-3-ium);methyl phosphate |
| SMILES | CCc1[nH]cc[n+]1C.CCc1[nH]cc[n+]1C.COP(=O)([O-])[O-] |
| InChI | InChI=1S/2C6H10N2.CH5O4P/c2*1-3-6-7-4-5-8(6)2;1-5-6(2,3)4/h2*4-5H,3H2,1-2H3;1H3,(H2,2,3,4) |
| InChIKey | DFUNEPYUHFZQLD-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|