C9H11F3N2O2 — CID 69091767
3-methyl-2-prop-2-enyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate (PubChem CID 69091767) has the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. Its IUPAC name is 3-methyl-2-prop-2-enyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate.
| Compound Name | 3-methyl-2-prop-2-enyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69091767 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-methyl-2-prop-2-enyl-1H-imidazol-3-ium;2,2,2-trifluoroacetate |
| SMILES | C=CCc1[nH]cc[n+]1C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H10N2.C2HF3O2/c1-3-4-7-8-5-6-9(7)2;3-2(4,5)1(6)7/h3,5-6H,1,4H2,2H3;(H,6,7) |
| InChIKey | DJMIJTPYOIZHLR-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|