C11H16F6N3O7S2+ — CID 25215514
2-methoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 25215514) has the molecular formula C11H16F6N3O7S2+ and a molecular weight of 480.39 g/mol. Its IUPAC name is 2-methoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 2-methoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 25215514 |
| Molecular Formula | C11H16F6N3O7S2+ |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 2-methoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | COCCOC(=O)Cc1[nH]cc[n+]1C.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14N2O3.C2HF6NO4S2/c1-11-4-3-10-8(11)7-9(12)14-6-5-13-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-4H,5-7H2,1-2H3;9H/p+1 |
| InChIKey | HVQPUAYZUQOPHB-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|