C15H21F6N3O7S2+2 — CID 87084059
[3-butoxy-1-methoxy-2-methyl-2-(3-methyl-1H-imidazol-3-ium-2-yl)-3-oxopropylidene]-bis(trifluoromethylsulfonyl)azanium (PubChem CID 87084059) has the molecular formula C15H21F6N3O7S2+2 and a molecular weight of 533.47 g/mol. Its IUPAC name is [3-butoxy-1-methoxy-2-methyl-2-(3-methyl-1H-imidazol-3-ium-2-yl)-3-oxopropylidene]-bis(trifluoromethylsulfonyl)azanium.
| Compound Name | [3-butoxy-1-methoxy-2-methyl-2-(3-methyl-1H-imidazol-3-ium-2-yl)-3-oxopropylidene]-bis(trifluoromethylsulfonyl)azanium |
|---|---|
| PubChem CID | 87084059 |
| Molecular Formula | C15H21F6N3O7S2+2 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | [3-butoxy-1-methoxy-2-methyl-2-(3-methyl-1H-imidazol-3-ium-2-yl)-3-oxopropylidene]-bis(trifluoromethylsulfonyl)azanium |
| SMILES | CCCCOC(=O)C(C)(C(OC)=[N+](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c1[nH]cc[n+]1C |
| InChI | InChI=1S/C15H20F6N3O7S2/c1-5-6-9-31-12(25)13(2,10-22-7-8-23(10)3)11(30-4)24(32(26,27)14(16,17)18)33(28,29)15(19,20)21/h7-8H,5-6,9H2,1-4H3/q+1/p+1 |
| InChIKey | SLDFDVPTCXWMCK-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|