About 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate
2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate (PubChem CID 87551991) has the molecular formula C12H21N2O3+
and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate.
Molecular Properties
| Compound Name | 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate |
| PubChem CID | 87551991 |
| Molecular Formula | C12H21N2O3+ |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate |
| SMILES | CCCCOCCOC(=O)Cc1[nH]cc[n+]1C |
| InChI | InChI=1S/C12H20N2O3/c1-3-4-7-16-8-9-17-12(15)10-11-13-5-6-14(11)2/h5-6H,3-4,7-10H2,1-2H3/p+1 |
| InChIKey | WLNVUNLJKGEWNJ-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate?
The IUPAC name of 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate (CID 87551991) is 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate.
What is the SMILES notation for 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate?
The canonical SMILES for 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate is CCCCOCCOC(=O)Cc1[nH]cc[n+]1C.
What is the InChIKey of 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate?
The InChIKey is WLNVUNLJKGEWNJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H20N2O3/c1-3-4-7-16-8-9-17-12(15)10-11-13-5-6-14(11)2/h5-6H,3-4,7-10H2,1-2H3/p+1.
What are the key properties of 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate?
2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate has a molecular weight of 241.31 g/mol, XLogP of 0.74, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethyl 2-(3-methyl-1H-imidazol-3-ium-2-yl)acetate is sourced from PubChem (CID 87551991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).