C16H26N4O4 — CID 173070153
1,3-dimethylimidazol-1-ium;3-methyl-2-prop-2-enyl-1H-imidazol-3-ium;diacetate (PubChem CID 173070153) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1,3-dimethylimidazol-1-ium;3-methyl-2-prop-2-enyl-1H-imidazol-3-ium;diacetate.
| Compound Name | 1,3-dimethylimidazol-1-ium;3-methyl-2-prop-2-enyl-1H-imidazol-3-ium;diacetate |
|---|---|
| PubChem CID | 173070153 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1,3-dimethylimidazol-1-ium;3-methyl-2-prop-2-enyl-1H-imidazol-3-ium;diacetate |
| SMILES | C=CCc1[nH]cc[n+]1C.CC(=O)[O-].CC(=O)[O-].Cn1cc[n+](C)c1 |
| InChI | InChI=1S/C7H10N2.C5H9N2.2C2H4O2/c1-3-4-7-8-5-6-9(7)2;1-6-3-4-7(2)5-6;2*1-2(3)4/h3,5-6H,1,4H2,2H3;3-5H,1-2H3;2*1H3,(H,3,4)/q;+1;;/p-1 |
| InChIKey | MFSMMZHKBAXNQO-UHFFFAOYSA-M |
| XLogP | -2.07 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|