C11H19N2O4P — CID 87765148
bis(prop-2-enyl) phosphate;1,3-dimethylimidazol-1-ium (PubChem CID 87765148) has the molecular formula C11H19N2O4P and a molecular weight of 274.26 g/mol. Its IUPAC name is bis(prop-2-enyl) phosphate;1,3-dimethylimidazol-1-ium.
| Compound Name | bis(prop-2-enyl) phosphate;1,3-dimethylimidazol-1-ium |
|---|---|
| PubChem CID | 87765148 |
| Molecular Formula | C11H19N2O4P |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | bis(prop-2-enyl) phosphate;1,3-dimethylimidazol-1-ium |
| SMILES | C=CCOP(=O)([O-])OCC=C.Cn1cc[n+](C)c1 |
| InChI | InChI=1S/C6H11O4P.C5H9N2/c1-3-5-9-11(7,8)10-6-4-2;1-6-3-4-7(2)5-6/h3-4H,1-2,5-6H2,(H,7,8);3-5H,1-2H3/q;+1/p-1 |
| InChIKey | TWAFEZKTVAJLFF-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|