C8H12N2O4 — CID 86715077
1,3-dimethylimidazol-1-ium;2-methoxy-2-oxoacetate (PubChem CID 86715077) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 1,3-dimethylimidazol-1-ium;2-methoxy-2-oxoacetate.
| Compound Name | 1,3-dimethylimidazol-1-ium;2-methoxy-2-oxoacetate |
|---|---|
| PubChem CID | 86715077 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1,3-dimethylimidazol-1-ium;2-methoxy-2-oxoacetate |
| SMILES | COC(=O)C(=O)[O-].Cn1cc[n+](C)c1 |
| InChI | InChI=1S/C5H9N2.C3H4O4/c1-6-3-4-7(2)5-6;1-7-3(6)2(4)5/h3-5H,1-2H3;1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | GJNNQLMNTIVWDP-UHFFFAOYSA-M |
| XLogP | -2.24 |
| TPSA | 75.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|