C7H16N2P+ — CID 158359102
1,3-dimethylimidazol-1-ium;dimethylphosphane (PubChem CID 158359102) has the molecular formula C7H16N2P+ and a molecular weight of 159.19 g/mol. Its IUPAC name is 1,3-dimethylimidazol-1-ium;dimethylphosphane.
| Compound Name | 1,3-dimethylimidazol-1-ium;dimethylphosphane |
|---|---|
| PubChem CID | 158359102 |
| Molecular Formula | C7H16N2P+ |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1,3-dimethylimidazol-1-ium;dimethylphosphane |
| SMILES | CPC.Cn1cc[n+](C)c1 |
| InChI | InChI=1S/C5H9N2.C2H7P/c1-6-3-4-7(2)5-6;1-3-2/h3-5H,1-2H3;3H,1-2H3/q+1; |
| InChIKey | GTGDCQKUKSIIJG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|