C8H12BN4+ — CID 56973030
CID 56973030 (PubChem CID 56973030) has the molecular formula C8H12BN4+ and a molecular weight of 175.02 g/mol.
| Compound Name | CID 56973030 |
|---|---|
| PubChem CID | 56973030 |
| Molecular Formula | C8H12BN4+ |
| Molecular Weight | 175.02 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | — |
| SMILES | Cn1cc[n+]([B-][n+]2ccn(C)c2)c1 |
| InChI | InChI=1S/C8H12BN4/c1-10-3-5-12(7-10)9-13-6-4-11(2)8-13/h3-8H,1-2H3/q+1 |
| InChIKey | IQGYTLYFPVCGFG-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.02 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|