C16H13ClF2N2O — CID 87262839
2-chloro-N-[(3,4-difluorophenyl)methyl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide (PubChem CID 87262839) has the molecular formula C16H13ClF2N2O and a molecular weight of 322.74 g/mol. Its IUPAC name is 2-chloro-N-[(3,4-difluorophenyl)methyl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(3,4-difluorophenyl)methyl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87262839 |
| Molecular Formula | C16H13ClF2N2O |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-chloro-N-[(3,4-difluorophenyl)methyl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(F)c1)c1cc2c(nc1Cl)CCC2 |
| InChI | InChI=1S/C16H13ClF2N2O/c17-15-11(7-10-2-1-3-14(10)21-15)16(22)20-8-9-4-5-12(18)13(19)6-9/h4-7H,1-3,8H2,(H,20,22) |
| InChIKey | USVZFKPCRHXYOQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|