C16H15N3O3 — CID 87266323
N-hydroxy-1-(2-phenoxyethyl)pyrrolo[3,2-c]pyridine-6-carboxamide (PubChem CID 87266323) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-hydroxy-1-(2-phenoxyethyl)pyrrolo[3,2-c]pyridine-6-carboxamide.
| Compound Name | N-hydroxy-1-(2-phenoxyethyl)pyrrolo[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 87266323 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-hydroxy-1-(2-phenoxyethyl)pyrrolo[3,2-c]pyridine-6-carboxamide |
| SMILES | O=C(NO)c1cc2c(ccn2CCOc2ccccc2)cn1 |
| InChI | InChI=1S/C16H15N3O3/c20-16(18-21)14-10-15-12(11-17-14)6-7-19(15)8-9-22-13-4-2-1-3-5-13/h1-7,10-11,21H,8-9H2,(H,18,20) |
| InChIKey | WBTXEIRYMNVMLP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|