C31H43N3O5 — CID 170703879
1-[2-[3-[[2-[2-(3-cyclopentylpropoxy)ethoxy]ethyl-methylamino]methyl]phenoxy]ethyl]-N-hydroxyindole-6-carboxamide (PubChem CID 170703879) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is 1-[2-[3-[[2-[2-(3-cyclopentylpropoxy)ethoxy]ethyl-methylamino]methyl]phenoxy]ethyl]-N-hydroxyindole-6-carboxamide.
| Compound Name | 1-[2-[3-[[2-[2-(3-cyclopentylpropoxy)ethoxy]ethyl-methylamino]methyl]phenoxy]ethyl]-N-hydroxyindole-6-carboxamide |
|---|---|
| PubChem CID | 170703879 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | 1-[2-[3-[[2-[2-(3-cyclopentylpropoxy)ethoxy]ethyl-methylamino]methyl]phenoxy]ethyl]-N-hydroxyindole-6-carboxamide |
| SMILES | CN(CCOCCOCCCC1CCCC1)Cc1cccc(OCCn2ccc3ccc(C(=O)NO)cc32)c1 |
| InChI | InChI=1S/C31H43N3O5/c1-33(15-18-38-21-20-37-17-5-9-25-6-2-3-7-25)24-26-8-4-10-29(22-26)39-19-16-34-14-13-27-11-12-28(23-30(27)34)31(35)32-36/h4,8,10-14,22-23,25,36H,2-3,5-7,9,15-21,24H2,1H3,(H,32,35) |
| InChIKey | GYDDYNGMPQKRHD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|